C20H23ClN4S — CID 6036727
1-(3-chlorophenyl)-3-[(Z)-(1-propyl-3,4-dihydro-2H-quinolin-6-yl)methylideneamino]thiourea (PubChem CID 6036727) has the molecular formula C20H23ClN4S and a molecular weight of 386.95 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[(Z)-(1-propyl-3,4-dihydro-2H-quinolin-6-yl)methylideneamino]thiourea.
| Compound Name | 1-(3-chlorophenyl)-3-[(Z)-(1-propyl-3,4-dihydro-2H-quinolin-6-yl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 6036727 |
| Molecular Formula | C20H23ClN4S |
| Molecular Weight | 386.95 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[(Z)-(1-propyl-3,4-dihydro-2H-quinolin-6-yl)methylideneamino]thiourea |
| SMILES | CCCN1CCCc2cc(/C=N\NC(=S)Nc3cccc(Cl)c3)ccc21 |
| InChI | InChI=1S/C20H23ClN4S/c1-2-10-25-11-4-5-16-12-15(8-9-19(16)25)14-22-24-20(26)23-18-7-3-6-17(21)13-18/h3,6-9,12-14H,2,4-5,10-11H2,1H3,(H2,23,24,26)/b22-14- |
| InChIKey | OUKVNEIPQBSYTP-HMAPJEAMSA-N |
| XLogP | 4.82 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.95 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|