C19H21ClN4S — CID 4112377
1-(3-chlorophenyl)-3-[(1-ethyl-3,4-dihydro-2H-quinolin-6-yl)methylideneamino]thiourea (PubChem CID 4112377) has the molecular formula C19H21ClN4S and a molecular weight of 372.93 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[(1-ethyl-3,4-dihydro-2H-quinolin-6-yl)methylideneamino]thiourea.
| Compound Name | 1-(3-chlorophenyl)-3-[(1-ethyl-3,4-dihydro-2H-quinolin-6-yl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 4112377 |
| Molecular Formula | C19H21ClN4S |
| Molecular Weight | 372.93 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[(1-ethyl-3,4-dihydro-2H-quinolin-6-yl)methylideneamino]thiourea |
| SMILES | CCN1CCCc2cc(C=NNC(=S)Nc3cccc(Cl)c3)ccc21 |
| InChI | InChI=1S/C19H21ClN4S/c1-2-24-10-4-5-15-11-14(8-9-18(15)24)13-21-23-19(25)22-17-7-3-6-16(20)12-17/h3,6-9,11-13H,2,4-5,10H2,1H3,(H2,22,23,25) |
| InChIKey | QTDGUQGSPGHANW-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.93 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|