C28H42N4S — CID 46373283
1-[3-(diethylamino)propyl]-3-(4-methylphenyl)-1-[(1-propyl-3,4-dihydro-2H-quinolin-6-yl)methyl]thiourea (PubChem CID 46373283) has the molecular formula C28H42N4S and a molecular weight of 466.74 g/mol. Its IUPAC name is 1-[3-(diethylamino)propyl]-3-(4-methylphenyl)-1-[(1-propyl-3,4-dihydro-2H-quinolin-6-yl)methyl]thiourea.
| Compound Name | 1-[3-(diethylamino)propyl]-3-(4-methylphenyl)-1-[(1-propyl-3,4-dihydro-2H-quinolin-6-yl)methyl]thiourea |
|---|---|
| PubChem CID | 46373283 |
| Molecular Formula | C28H42N4S |
| Molecular Weight | 466.74 g/mol |
| Exact Mass | 466.31 |
| IUPAC Name | 1-[3-(diethylamino)propyl]-3-(4-methylphenyl)-1-[(1-propyl-3,4-dihydro-2H-quinolin-6-yl)methyl]thiourea |
| SMILES | CCCN1CCCc2cc(CN(CCCN(CC)CC)C(=S)Nc3ccc(C)cc3)ccc21 |
| InChI | InChI=1S/C28H42N4S/c1-5-17-31-19-8-10-25-21-24(13-16-27(25)31)22-32(20-9-18-30(6-2)7-3)28(33)29-26-14-11-23(4)12-15-26/h11-16,21H,5-10,17-20,22H2,1-4H3,(H,29,33) |
| InChIKey | WNPFHXCVGGODPD-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 21.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.74 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|