C27H39N3OS — CID 3429546
3-(2,5-dimethylphenyl)-1-(3-ethoxypropyl)-1-[(1-propyl-3,4-dihydro-2H-quinolin-6-yl)methyl]thiourea (PubChem CID 3429546) has the molecular formula C27H39N3OS and a molecular weight of 453.70 g/mol. Its IUPAC name is 3-(2,5-dimethylphenyl)-1-(3-ethoxypropyl)-1-[(1-propyl-3,4-dihydro-2H-quinolin-6-yl)methyl]thiourea.
| Compound Name | 3-(2,5-dimethylphenyl)-1-(3-ethoxypropyl)-1-[(1-propyl-3,4-dihydro-2H-quinolin-6-yl)methyl]thiourea |
|---|---|
| PubChem CID | 3429546 |
| Molecular Formula | C27H39N3OS |
| Molecular Weight | 453.70 g/mol |
| Exact Mass | 453.28 |
| IUPAC Name | 3-(2,5-dimethylphenyl)-1-(3-ethoxypropyl)-1-[(1-propyl-3,4-dihydro-2H-quinolin-6-yl)methyl]thiourea |
| SMILES | CCCN1CCCc2cc(CN(CCCOCC)C(=S)Nc3cc(C)ccc3C)ccc21 |
| InChI | InChI=1S/C27H39N3OS/c1-5-14-29-15-7-9-24-19-23(12-13-26(24)29)20-30(16-8-17-31-6-2)27(32)28-25-18-21(3)10-11-22(25)4/h10-13,18-19H,5-9,14-17,20H2,1-4H3,(H,28,32) |
| InChIKey | UJUIEKHPMCFBDS-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.70 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|