C26H37N3S — CID 5067611
1-butan-2-yl-3-(2-ethylphenyl)-1-[(1-propyl-3,4-dihydro-2H-quinolin-6-yl)methyl]thiourea (PubChem CID 5067611) has the molecular formula C26H37N3S and a molecular weight of 423.67 g/mol. Its IUPAC name is 1-butan-2-yl-3-(2-ethylphenyl)-1-[(1-propyl-3,4-dihydro-2H-quinolin-6-yl)methyl]thiourea.
| Compound Name | 1-butan-2-yl-3-(2-ethylphenyl)-1-[(1-propyl-3,4-dihydro-2H-quinolin-6-yl)methyl]thiourea |
|---|---|
| PubChem CID | 5067611 |
| Molecular Formula | C26H37N3S |
| Molecular Weight | 423.67 g/mol |
| Exact Mass | 423.27 |
| IUPAC Name | 1-butan-2-yl-3-(2-ethylphenyl)-1-[(1-propyl-3,4-dihydro-2H-quinolin-6-yl)methyl]thiourea |
| SMILES | CCCN1CCCc2cc(CN(C(=S)Nc3ccccc3CC)C(C)CC)ccc21 |
| InChI | InChI=1S/C26H37N3S/c1-5-16-28-17-10-12-23-18-21(14-15-25(23)28)19-29(20(4)6-2)26(30)27-24-13-9-8-11-22(24)7-3/h8-9,11,13-15,18,20H,5-7,10,12,16-17,19H2,1-4H3,(H,27,30) |
| InChIKey | SKEVSQHWDOCOTB-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.67 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|