C24H32ClN3OS — CID 4290345
3-(3-chloro-2-methylphenyl)-1-(2-methoxyethyl)-1-[(1-propyl-3,4-dihydro-2H-quinolin-6-yl)methyl]thiourea (PubChem CID 4290345) has the molecular formula C24H32ClN3OS and a molecular weight of 446.06 g/mol. Its IUPAC name is 3-(3-chloro-2-methylphenyl)-1-(2-methoxyethyl)-1-[(1-propyl-3,4-dihydro-2H-quinolin-6-yl)methyl]thiourea.
| Compound Name | 3-(3-chloro-2-methylphenyl)-1-(2-methoxyethyl)-1-[(1-propyl-3,4-dihydro-2H-quinolin-6-yl)methyl]thiourea |
|---|---|
| PubChem CID | 4290345 |
| Molecular Formula | C24H32ClN3OS |
| Molecular Weight | 446.06 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | 3-(3-chloro-2-methylphenyl)-1-(2-methoxyethyl)-1-[(1-propyl-3,4-dihydro-2H-quinolin-6-yl)methyl]thiourea |
| SMILES | CCCN1CCCc2cc(CN(CCOC)C(=S)Nc3cccc(Cl)c3C)ccc21 |
| InChI | InChI=1S/C24H32ClN3OS/c1-4-12-27-13-6-7-20-16-19(10-11-23(20)27)17-28(14-15-29-3)24(30)26-22-9-5-8-21(25)18(22)2/h5,8-11,16H,4,6-7,12-15,17H2,1-3H3,(H,26,30) |
| InChIKey | UOQOJCFJKHDUOR-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.06 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|