C16H25ClN2S — CID 19653149
1,1-dibutyl-3-(3-chloro-2-methylphenyl)thiourea (PubChem CID 19653149) has the molecular formula C16H25ClN2S and a molecular weight of 312.91 g/mol. Its IUPAC name is 1,1-dibutyl-3-(3-chloro-2-methylphenyl)thiourea.
| Compound Name | 1,1-dibutyl-3-(3-chloro-2-methylphenyl)thiourea |
|---|---|
| PubChem CID | 19653149 |
| Molecular Formula | C16H25ClN2S |
| Molecular Weight | 312.91 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 1,1-dibutyl-3-(3-chloro-2-methylphenyl)thiourea |
| SMILES | CCCCN(CCCC)C(=S)Nc1cccc(Cl)c1C |
| InChI | InChI=1S/C16H25ClN2S/c1-4-6-11-19(12-7-5-2)16(20)18-15-10-8-9-14(17)13(15)3/h8-10H,4-7,11-12H2,1-3H3,(H,18,20) |
| InChIKey | AZIWASKGMGBBHG-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.91 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|