C14H17ClN2S — CID 19653077
3-(3-chloro-2-methylphenyl)-1,1-bis(prop-2-enyl)thiourea (PubChem CID 19653077) has the molecular formula C14H17ClN2S and a molecular weight of 280.82 g/mol. Its IUPAC name is 3-(3-chloro-2-methylphenyl)-1,1-bis(prop-2-enyl)thiourea.
| Compound Name | 3-(3-chloro-2-methylphenyl)-1,1-bis(prop-2-enyl)thiourea |
|---|---|
| PubChem CID | 19653077 |
| Molecular Formula | C14H17ClN2S |
| Molecular Weight | 280.82 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 3-(3-chloro-2-methylphenyl)-1,1-bis(prop-2-enyl)thiourea |
| SMILES | C=CCN(CC=C)C(=S)Nc1cccc(Cl)c1C |
| InChI | InChI=1S/C14H17ClN2S/c1-4-9-17(10-5-2)14(18)16-13-8-6-7-12(15)11(13)3/h4-8H,1-2,9-10H2,3H3,(H,16,18) |
| InChIKey | XNLJVUJCMRUYFV-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.82 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|