C14H22ClN3S — CID 8656190
1-(3-chloro-2-methylphenyl)-3-[2-(diethylamino)ethyl]thiourea (PubChem CID 8656190) has the molecular formula C14H22ClN3S and a molecular weight of 299.87 g/mol. Its IUPAC name is 1-(3-chloro-2-methylphenyl)-3-[2-(diethylamino)ethyl]thiourea.
| Compound Name | 1-(3-chloro-2-methylphenyl)-3-[2-(diethylamino)ethyl]thiourea |
|---|---|
| PubChem CID | 8656190 |
| Molecular Formula | C14H22ClN3S |
| Molecular Weight | 299.87 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 1-(3-chloro-2-methylphenyl)-3-[2-(diethylamino)ethyl]thiourea |
| SMILES | CCN(CC)CCNC(=S)Nc1cccc(Cl)c1C |
| InChI | InChI=1S/C14H22ClN3S/c1-4-18(5-2)10-9-16-14(19)17-13-8-6-7-12(15)11(13)3/h6-8H,4-5,9-10H2,1-3H3,(H2,16,17,19) |
| InChIKey | KTLNVHZZBAYNJZ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.87 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|