C28H38ClN3S — CID 124775463
3-(3-chloro-2-methylphenyl)-1-[(1R,2R)-2-methylcyclohexyl]-1-[(1-propyl-3,4-dihydro-2H-quinolin-6-yl)methyl]thiourea (PubChem CID 124775463) has the molecular formula C28H38ClN3S and a molecular weight of 484.15 g/mol. Its IUPAC name is 3-(3-chloro-2-methylphenyl)-1-[(1R,2R)-2-methylcyclohexyl]-1-[(1-propyl-3,4-dihydro-2H-quinolin-6-yl)methyl]thiourea.
| Compound Name | 3-(3-chloro-2-methylphenyl)-1-[(1R,2R)-2-methylcyclohexyl]-1-[(1-propyl-3,4-dihydro-2H-quinolin-6-yl)methyl]thiourea |
|---|---|
| PubChem CID | 124775463 |
| Molecular Formula | C28H38ClN3S |
| Molecular Weight | 484.15 g/mol |
| Exact Mass | 483.25 |
| IUPAC Name | 3-(3-chloro-2-methylphenyl)-1-[(1R,2R)-2-methylcyclohexyl]-1-[(1-propyl-3,4-dihydro-2H-quinolin-6-yl)methyl]thiourea |
| SMILES | CCCN1CCCc2cc(CN(C(=S)Nc3cccc(Cl)c3C)[C@@H]3CCCC[C@H]3C)ccc21 |
| InChI | InChI=1S/C28H38ClN3S/c1-4-16-31-17-8-10-23-18-22(14-15-27(23)31)19-32(26-13-6-5-9-20(26)2)28(33)30-25-12-7-11-24(29)21(25)3/h7,11-12,14-15,18,20,26H,4-6,8-10,13,16-17,19H2,1-3H3,(H,30,33)/t20-,26-/m1/s1 |
| InChIKey | GMSKMPRLBVMXEU-FQRUVTKNSA-N |
| XLogP | 7.59 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.15 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|