C28H41N3OS — CID 46373311
1-[(1-butyl-3,4-dihydro-2H-quinolin-6-yl)methyl]-3-(2,6-dimethylphenyl)-1-(3-ethoxypropyl)thiourea (PubChem CID 46373311) has the molecular formula C28H41N3OS and a molecular weight of 467.72 g/mol. Its IUPAC name is 1-[(1-butyl-3,4-dihydro-2H-quinolin-6-yl)methyl]-3-(2,6-dimethylphenyl)-1-(3-ethoxypropyl)thiourea.
| Compound Name | 1-[(1-butyl-3,4-dihydro-2H-quinolin-6-yl)methyl]-3-(2,6-dimethylphenyl)-1-(3-ethoxypropyl)thiourea |
|---|---|
| PubChem CID | 46373311 |
| Molecular Formula | C28H41N3OS |
| Molecular Weight | 467.72 g/mol |
| Exact Mass | 467.30 |
| IUPAC Name | 1-[(1-butyl-3,4-dihydro-2H-quinolin-6-yl)methyl]-3-(2,6-dimethylphenyl)-1-(3-ethoxypropyl)thiourea |
| SMILES | CCCCN1CCCc2cc(CN(CCCOCC)C(=S)Nc3c(C)cccc3C)ccc21 |
| InChI | InChI=1S/C28H41N3OS/c1-5-7-16-30-17-9-13-25-20-24(14-15-26(25)30)21-31(18-10-19-32-6-2)28(33)29-27-22(3)11-8-12-23(27)4/h8,11-12,14-15,20H,5-7,9-10,13,16-19,21H2,1-4H3,(H,29,33) |
| InChIKey | GDIIGPULRXFTTK-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.72 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|