C14H23N — CID 143643901
ethane;1-ethyl-6-methyl-3,4-dihydro-2H-quinoline (PubChem CID 143643901) has the molecular formula C14H23N and a molecular weight of 205.34 g/mol. Its IUPAC name is ethane;1-ethyl-6-methyl-3,4-dihydro-2H-quinoline.
| Compound Name | ethane;1-ethyl-6-methyl-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 143643901 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | ethane;1-ethyl-6-methyl-3,4-dihydro-2H-quinoline |
| SMILES | CC.CCN1CCCc2cc(C)ccc21 |
| InChI | InChI=1S/C12H17N.C2H6/c1-3-13-8-4-5-11-9-10(2)6-7-12(11)13;1-2/h6-7,9H,3-5,8H2,1-2H3;1-2H3 |
| InChIKey | VCKNOLIJPGWRKP-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |