C11H14BF3KN — CID 63702785
potassium trifluoro-[(6-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]boranuide (PubChem CID 63702785) has the molecular formula C11H14BF3KN and a molecular weight of 267.14 g/mol. Its IUPAC name is potassium trifluoro-[(6-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]boranuide.
| Compound Name | potassium trifluoro-[(6-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]boranuide |
|---|---|
| PubChem CID | 63702785 |
| Molecular Formula | C11H14BF3KN |
| Molecular Weight | 267.14 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | potassium trifluoro-[(6-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]boranuide |
| SMILES | Cc1ccc2c(c1)CCCN2C[B-](F)(F)F.[K+] |
| InChI | InChI=1S/C11H14BF3N.K/c1-9-4-5-11-10(7-9)3-2-6-16(11)8-12(13,14)15;/h4-5,7H,2-3,6,8H2,1H3;/q-1;+1 |
| InChIKey | SUEXEWZIZPFPTC-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.14 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|