About N-[2-(6-methyl-3,4-dihydro-2H-quinolin-1-yl)ethyl]aniline
N-[2-(6-methyl-3,4-dihydro-2H-quinolin-1-yl)ethyl]aniline (PubChem CID 60861432) has the molecular formula C18H22N2
and a molecular weight of 266.39 g/mol. Its IUPAC name is N-[2-(6-methyl-3,4-dihydro-2H-quinolin-1-yl)ethyl]aniline.
Molecular Properties
| Compound Name | N-[2-(6-methyl-3,4-dihydro-2H-quinolin-1-yl)ethyl]aniline |
| PubChem CID | 60861432 |
| Molecular Formula | C18H22N2 |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.18 |
| IUPAC Name | N-[2-(6-methyl-3,4-dihydro-2H-quinolin-1-yl)ethyl]aniline |
| SMILES | Cc1ccc2c(c1)CCCN2CCNc1ccccc1 |
| InChI | InChI=1S/C18H22N2/c1-15-9-10-18-16(14-15)6-5-12-20(18)13-11-19-17-7-3-2-4-8-17/h2-4,7-10,14,19H,5-6,11-13H2,1H3 |
| InChIKey | RYJXHAMSPQTHRL-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[2-(6-methyl-3,4-dihydro-2H-quinolin-1-yl)ethyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(6-methyl-3,4-dihydro-2H-quinolin-1-yl)ethyl]aniline?
The IUPAC name of N-[2-(6-methyl-3,4-dihydro-2H-quinolin-1-yl)ethyl]aniline (CID 60861432) is N-[2-(6-methyl-3,4-dihydro-2H-quinolin-1-yl)ethyl]aniline.
What is the SMILES notation for N-[2-(6-methyl-3,4-dihydro-2H-quinolin-1-yl)ethyl]aniline?
The canonical SMILES for N-[2-(6-methyl-3,4-dihydro-2H-quinolin-1-yl)ethyl]aniline is Cc1ccc2c(c1)CCCN2CCNc1ccccc1.
What is the InChIKey of N-[2-(6-methyl-3,4-dihydro-2H-quinolin-1-yl)ethyl]aniline?
The InChIKey is RYJXHAMSPQTHRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N2/c1-15-9-10-18-16(14-15)6-5-12-20(18)13-11-19-17-7-3-2-4-8-17/h2-4,7-10,14,19H,5-6,11-13H2,1H3.
What are the key properties of N-[2-(6-methyl-3,4-dihydro-2H-quinolin-1-yl)ethyl]aniline?
N-[2-(6-methyl-3,4-dihydro-2H-quinolin-1-yl)ethyl]aniline has a molecular weight of 266.39 g/mol, XLogP of 3.86, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(6-methyl-3,4-dihydro-2H-quinolin-1-yl)ethyl]aniline is sourced from PubChem (CID 60861432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).