C18H22N2 — CID 54806518
N-[2-(2,3-dihydroindol-1-yl)ethyl]-2,5-dimethylaniline (PubChem CID 54806518) has the molecular formula C18H22N2 and a molecular weight of 266.39 g/mol. Its IUPAC name is N-[2-(2,3-dihydroindol-1-yl)ethyl]-2,5-dimethylaniline.
| Compound Name | N-[2-(2,3-dihydroindol-1-yl)ethyl]-2,5-dimethylaniline |
|---|---|
| PubChem CID | 54806518 |
| Molecular Formula | C18H22N2 |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.18 |
| IUPAC Name | N-[2-(2,3-dihydroindol-1-yl)ethyl]-2,5-dimethylaniline |
| SMILES | Cc1ccc(C)c(NCCN2CCc3ccccc32)c1 |
| InChI | InChI=1S/C18H22N2/c1-14-7-8-15(2)17(13-14)19-10-12-20-11-9-16-5-3-4-6-18(16)20/h3-8,13,19H,9-12H2,1-2H3 |
| InChIKey | SADMLGQYCLDIHR-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |