C19H22N2O — CID 109034719
1-(2,3-dihydroindol-1-yl)-3-(2,4-dimethylanilino)propan-1-one (PubChem CID 109034719) has the molecular formula C19H22N2O and a molecular weight of 294.40 g/mol. Its IUPAC name is 1-(2,3-dihydroindol-1-yl)-3-(2,4-dimethylanilino)propan-1-one.
| Compound Name | 1-(2,3-dihydroindol-1-yl)-3-(2,4-dimethylanilino)propan-1-one |
|---|---|
| PubChem CID | 109034719 |
| Molecular Formula | C19H22N2O |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 1-(2,3-dihydroindol-1-yl)-3-(2,4-dimethylanilino)propan-1-one |
| SMILES | Cc1ccc(NCCC(=O)N2CCc3ccccc32)c(C)c1 |
| InChI | InChI=1S/C19H22N2O/c1-14-7-8-17(15(2)13-14)20-11-9-19(22)21-12-10-16-5-3-4-6-18(16)21/h3-8,13,20H,9-12H2,1-2H3 |
| InChIKey | WLPNMIALRNXIFK-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |