C21H27N3O — CID 109027051
3-(2,4-dimethylanilino)-1-(4-phenylpiperazin-1-yl)propan-1-one (PubChem CID 109027051) has the molecular formula C21H27N3O and a molecular weight of 337.47 g/mol. Its IUPAC name is 3-(2,4-dimethylanilino)-1-(4-phenylpiperazin-1-yl)propan-1-one.
| Compound Name | 3-(2,4-dimethylanilino)-1-(4-phenylpiperazin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 109027051 |
| Molecular Formula | C21H27N3O |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.22 |
| IUPAC Name | 3-(2,4-dimethylanilino)-1-(4-phenylpiperazin-1-yl)propan-1-one |
| SMILES | Cc1ccc(NCCC(=O)N2CCN(c3ccccc3)CC2)c(C)c1 |
| InChI | InChI=1S/C21H27N3O/c1-17-8-9-20(18(2)16-17)22-11-10-21(25)24-14-12-23(13-15-24)19-6-4-3-5-7-19/h3-9,16,22H,10-15H2,1-2H3 |
| InChIKey | FHSSNRUORNJAKD-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |