C28H31Cl2N5O2 — CID 58258613
N-(2,6-dichlorophenyl)-4-[4-[3-(2,4-dimethylanilino)propanoylamino]phenyl]piperazine-1-carboxamide (PubChem CID 58258613) has the molecular formula C28H31Cl2N5O2 and a molecular weight of 540.50 g/mol. Its IUPAC name is N-(2,6-dichlorophenyl)-4-[4-[3-(2,4-dimethylanilino)propanoylamino]phenyl]piperazine-1-carboxamide.
| Compound Name | N-(2,6-dichlorophenyl)-4-[4-[3-(2,4-dimethylanilino)propanoylamino]phenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 58258613 |
| Molecular Formula | C28H31Cl2N5O2 |
| Molecular Weight | 540.50 g/mol |
| Exact Mass | 539.19 |
| IUPAC Name | N-(2,6-dichlorophenyl)-4-[4-[3-(2,4-dimethylanilino)propanoylamino]phenyl]piperazine-1-carboxamide |
| SMILES | Cc1ccc(NCCC(=O)Nc2ccc(N3CCN(C(=O)Nc4c(Cl)cccc4Cl)CC3)cc2)c(C)c1 |
| InChI | InChI=1S/C28H31Cl2N5O2/c1-19-6-11-25(20(2)18-19)31-13-12-26(36)32-21-7-9-22(10-8-21)34-14-16-35(17-15-34)28(37)33-27-23(29)4-3-5-24(27)30/h3-11,18,31H,12-17H2,1-2H3,(H,32,36)(H,33,37) |
| InChIKey | KXKWAMXMQYHGDX-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.50 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|