C30H37N5O3 — CID 70949288
4-[4-[[2-(2,4-dimethylanilino)acetyl]amino]phenyl]-N-(2-methoxy-4,6-dimethylphenyl)piperazine-1-carboxamide (PubChem CID 70949288) has the molecular formula C30H37N5O3 and a molecular weight of 515.66 g/mol. Its IUPAC name is 4-[4-[[2-(2,4-dimethylanilino)acetyl]amino]phenyl]-N-(2-methoxy-4,6-dimethylphenyl)piperazine-1-carboxamide.
| Compound Name | 4-[4-[[2-(2,4-dimethylanilino)acetyl]amino]phenyl]-N-(2-methoxy-4,6-dimethylphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 70949288 |
| Molecular Formula | C30H37N5O3 |
| Molecular Weight | 515.66 g/mol |
| Exact Mass | 515.29 |
| IUPAC Name | 4-[4-[[2-(2,4-dimethylanilino)acetyl]amino]phenyl]-N-(2-methoxy-4,6-dimethylphenyl)piperazine-1-carboxamide |
| SMILES | COc1cc(C)cc(C)c1NC(=O)N1CCN(c2ccc(NC(=O)CNc3ccc(C)cc3C)cc2)CC1 |
| InChI | InChI=1S/C30H37N5O3/c1-20-6-11-26(22(3)16-20)31-19-28(36)32-24-7-9-25(10-8-24)34-12-14-35(15-13-34)30(37)33-29-23(4)17-21(2)18-27(29)38-5/h6-11,16-18,31H,12-15,19H2,1-5H3,(H,32,36)(H,33,37) |
| InChIKey | RZIPDNUVIFVPAF-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.66 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|