C24H32N4O — CID 113112439
N-(4-pyrrolidin-1-ylphenyl)-4-(2,4,6-trimethylphenyl)piperazine-1-carboxamide (PubChem CID 113112439) has the molecular formula C24H32N4O and a molecular weight of 392.55 g/mol. Its IUPAC name is N-(4-pyrrolidin-1-ylphenyl)-4-(2,4,6-trimethylphenyl)piperazine-1-carboxamide.
| Compound Name | N-(4-pyrrolidin-1-ylphenyl)-4-(2,4,6-trimethylphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 113112439 |
| Molecular Formula | C24H32N4O |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.26 |
| IUPAC Name | N-(4-pyrrolidin-1-ylphenyl)-4-(2,4,6-trimethylphenyl)piperazine-1-carboxamide |
| SMILES | Cc1cc(C)c(N2CCN(C(=O)Nc3ccc(N4CCCC4)cc3)CC2)c(C)c1 |
| InChI | InChI=1S/C24H32N4O/c1-18-16-19(2)23(20(3)17-18)27-12-14-28(15-13-27)24(29)25-21-6-8-22(9-7-21)26-10-4-5-11-26/h6-9,16-17H,4-5,10-15H2,1-3H3,(H,25,29) |
| InChIKey | SQZIJRDNBDRWRG-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|