C23H30N4O — CID 113111533
4-(2,5-dimethylphenyl)-N-(4-pyrrolidin-1-ylphenyl)piperazine-1-carboxamide (PubChem CID 113111533) has the molecular formula C23H30N4O and a molecular weight of 378.52 g/mol. Its IUPAC name is 4-(2,5-dimethylphenyl)-N-(4-pyrrolidin-1-ylphenyl)piperazine-1-carboxamide.
| Compound Name | 4-(2,5-dimethylphenyl)-N-(4-pyrrolidin-1-ylphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 113111533 |
| Molecular Formula | C23H30N4O |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | 4-(2,5-dimethylphenyl)-N-(4-pyrrolidin-1-ylphenyl)piperazine-1-carboxamide |
| SMILES | Cc1ccc(C)c(N2CCN(C(=O)Nc3ccc(N4CCCC4)cc3)CC2)c1 |
| InChI | InChI=1S/C23H30N4O/c1-18-5-6-19(2)22(17-18)26-13-15-27(16-14-26)23(28)24-20-7-9-21(10-8-20)25-11-3-4-12-25/h5-10,17H,3-4,11-16H2,1-2H3,(H,24,28) |
| InChIKey | YLYWCSUIBGITQO-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|