C19H25N5O2 — CID 113114488
4-(5-methyl-1,2-oxazol-3-yl)-N-(4-pyrrolidin-1-ylphenyl)piperazine-1-carboxamide (PubChem CID 113114488) has the molecular formula C19H25N5O2 and a molecular weight of 355.44 g/mol. Its IUPAC name is 4-(5-methyl-1,2-oxazol-3-yl)-N-(4-pyrrolidin-1-ylphenyl)piperazine-1-carboxamide.
| Compound Name | 4-(5-methyl-1,2-oxazol-3-yl)-N-(4-pyrrolidin-1-ylphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 113114488 |
| Molecular Formula | C19H25N5O2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | 4-(5-methyl-1,2-oxazol-3-yl)-N-(4-pyrrolidin-1-ylphenyl)piperazine-1-carboxamide |
| SMILES | Cc1cc(N2CCN(C(=O)Nc3ccc(N4CCCC4)cc3)CC2)no1 |
| InChI | InChI=1S/C19H25N5O2/c1-15-14-18(21-26-15)23-10-12-24(13-11-23)19(25)20-16-4-6-17(7-5-16)22-8-2-3-9-22/h4-7,14H,2-3,8-13H2,1H3,(H,20,25) |
| InChIKey | HJNGUFFPTGZPRD-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 64.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|