C19H22ClN3O — CID 113111729
N-(4-chlorophenyl)-4-(3,5-dimethylphenyl)piperazine-1-carboxamide (PubChem CID 113111729) has the molecular formula C19H22ClN3O and a molecular weight of 343.86 g/mol. Its IUPAC name is N-(4-chlorophenyl)-4-(3,5-dimethylphenyl)piperazine-1-carboxamide.
| Compound Name | N-(4-chlorophenyl)-4-(3,5-dimethylphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 113111729 |
| Molecular Formula | C19H22ClN3O |
| Molecular Weight | 343.86 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | N-(4-chlorophenyl)-4-(3,5-dimethylphenyl)piperazine-1-carboxamide |
| SMILES | Cc1cc(C)cc(N2CCN(C(=O)Nc3ccc(Cl)cc3)CC2)c1 |
| InChI | InChI=1S/C19H22ClN3O/c1-14-11-15(2)13-18(12-14)22-7-9-23(10-8-22)19(24)21-17-5-3-16(20)4-6-17/h3-6,11-13H,7-10H2,1-2H3,(H,21,24) |
| InChIKey | NQVHVCMYVIFWCD-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.86 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |