C25H31Cl2N5O2 — CID 58258690
4-[4-[[2-(cyclohexylamino)acetyl]amino]phenyl]-N-(2,6-dichlorophenyl)piperazine-1-carboxamide (PubChem CID 58258690) has the molecular formula C25H31Cl2N5O2 and a molecular weight of 504.46 g/mol. Its IUPAC name is 4-[4-[[2-(cyclohexylamino)acetyl]amino]phenyl]-N-(2,6-dichlorophenyl)piperazine-1-carboxamide.
| Compound Name | 4-[4-[[2-(cyclohexylamino)acetyl]amino]phenyl]-N-(2,6-dichlorophenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 58258690 |
| Molecular Formula | C25H31Cl2N5O2 |
| Molecular Weight | 504.46 g/mol |
| Exact Mass | 503.19 |
| IUPAC Name | 4-[4-[[2-(cyclohexylamino)acetyl]amino]phenyl]-N-(2,6-dichlorophenyl)piperazine-1-carboxamide |
| SMILES | O=C(CNC1CCCCC1)Nc1ccc(N2CCN(C(=O)Nc3c(Cl)cccc3Cl)CC2)cc1 |
| InChI | InChI=1S/C25H31Cl2N5O2/c26-21-7-4-8-22(27)24(21)30-25(34)32-15-13-31(14-16-32)20-11-9-19(10-12-20)29-23(33)17-28-18-5-2-1-3-6-18/h4,7-12,18,28H,1-3,5-6,13-17H2,(H,29,33)(H,30,34) |
| InChIKey | SFCNSEQKERZDCZ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.46 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|