C25H32ClN5O2 — CID 91221530
N-(2-chloro-6-methylphenyl)-4-[4-(cyclohexylcarbamoylamino)phenyl]piperazine-1-carboxamide (PubChem CID 91221530) has the molecular formula C25H32ClN5O2 and a molecular weight of 470.02 g/mol. Its IUPAC name is N-(2-chloro-6-methylphenyl)-4-[4-(cyclohexylcarbamoylamino)phenyl]piperazine-1-carboxamide.
| Compound Name | N-(2-chloro-6-methylphenyl)-4-[4-(cyclohexylcarbamoylamino)phenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 91221530 |
| Molecular Formula | C25H32ClN5O2 |
| Molecular Weight | 470.02 g/mol |
| Exact Mass | 469.22 |
| IUPAC Name | N-(2-chloro-6-methylphenyl)-4-[4-(cyclohexylcarbamoylamino)phenyl]piperazine-1-carboxamide |
| SMILES | Cc1cccc(Cl)c1NC(=O)N1CCN(c2ccc(NC(=O)NC3CCCCC3)cc2)CC1 |
| InChI | InChI=1S/C25H32ClN5O2/c1-18-6-5-9-22(26)23(18)29-25(33)31-16-14-30(15-17-31)21-12-10-20(11-13-21)28-24(32)27-19-7-3-2-4-8-19/h5-6,9-13,19H,2-4,7-8,14-17H2,1H3,(H,29,33)(H2,27,28,32) |
| InChIKey | GOTYZKHKQXUZCL-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.02 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|