C17H18Cl2N4O — CID 59419439
4-(4-aminophenyl)-N-(2,6-dichlorophenyl)piperazine-1-carboxamide (PubChem CID 59419439) has the molecular formula C17H18Cl2N4O and a molecular weight of 365.26 g/mol. Its IUPAC name is 4-(4-aminophenyl)-N-(2,6-dichlorophenyl)piperazine-1-carboxamide.
| Compound Name | 4-(4-aminophenyl)-N-(2,6-dichlorophenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 59419439 |
| Molecular Formula | C17H18Cl2N4O |
| Molecular Weight | 365.26 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | 4-(4-aminophenyl)-N-(2,6-dichlorophenyl)piperazine-1-carboxamide |
| SMILES | Nc1ccc(N2CCN(C(=O)Nc3c(Cl)cccc3Cl)CC2)cc1 |
| InChI | InChI=1S/C17H18Cl2N4O/c18-14-2-1-3-15(19)16(14)21-17(24)23-10-8-22(9-11-23)13-6-4-12(20)5-7-13/h1-7H,8-11,20H2,(H,21,24) |
| InChIKey | SDZDGODYGPTJKZ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.26 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|