C21H25Cl2N5O2 — CID 70863115
4-[4-(3-aminobutanoylamino)phenyl]-N-(2,6-dichlorophenyl)piperazine-1-carboxamide (PubChem CID 70863115) has the molecular formula C21H25Cl2N5O2 and a molecular weight of 450.37 g/mol. Its IUPAC name is 4-[4-(3-aminobutanoylamino)phenyl]-N-(2,6-dichlorophenyl)piperazine-1-carboxamide.
| Compound Name | 4-[4-(3-aminobutanoylamino)phenyl]-N-(2,6-dichlorophenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 70863115 |
| Molecular Formula | C21H25Cl2N5O2 |
| Molecular Weight | 450.37 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | 4-[4-(3-aminobutanoylamino)phenyl]-N-(2,6-dichlorophenyl)piperazine-1-carboxamide |
| SMILES | CC(N)CC(=O)Nc1ccc(N2CCN(C(=O)Nc3c(Cl)cccc3Cl)CC2)cc1 |
| InChI | InChI=1S/C21H25Cl2N5O2/c1-14(24)13-19(29)25-15-5-7-16(8-6-15)27-9-11-28(12-10-27)21(30)26-20-17(22)3-2-4-18(20)23/h2-8,14H,9-13,24H2,1H3,(H,25,29)(H,26,30) |
| InChIKey | JECDQTMCYQMXIS-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.37 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|