C17H19FN2 — CID 103503442
N-[2-(6-fluoro-2,3-dihydroindol-1-yl)ethyl]-2-methylaniline (PubChem CID 103503442) has the molecular formula C17H19FN2 and a molecular weight of 270.35 g/mol. Its IUPAC name is N-[2-(6-fluoro-2,3-dihydroindol-1-yl)ethyl]-2-methylaniline.
| Compound Name | N-[2-(6-fluoro-2,3-dihydroindol-1-yl)ethyl]-2-methylaniline |
|---|---|
| PubChem CID | 103503442 |
| Molecular Formula | C17H19FN2 |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | N-[2-(6-fluoro-2,3-dihydroindol-1-yl)ethyl]-2-methylaniline |
| SMILES | Cc1ccccc1NCCN1CCc2ccc(F)cc21 |
| InChI | InChI=1S/C17H19FN2/c1-13-4-2-3-5-16(13)19-9-11-20-10-8-14-6-7-15(18)12-17(14)20/h2-7,12,19H,8-11H2,1H3 |
| InChIKey | DPHIPDFLXFFLRY-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |