About N-ethyl-3-(6-fluoro-2,3-dihydroindol-1-yl)propan-1-amine
N-ethyl-3-(6-fluoro-2,3-dihydroindol-1-yl)propan-1-amine (PubChem CID 103494949) has the molecular formula C13H19FN2
and a molecular weight of 222.31 g/mol. Its IUPAC name is N-ethyl-3-(6-fluoro-2,3-dihydroindol-1-yl)propan-1-amine.
Molecular Properties
| Compound Name | N-ethyl-3-(6-fluoro-2,3-dihydroindol-1-yl)propan-1-amine |
| PubChem CID | 103494949 |
| Molecular Formula | C13H19FN2 |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | N-ethyl-3-(6-fluoro-2,3-dihydroindol-1-yl)propan-1-amine |
| SMILES | CCNCCCN1CCc2ccc(F)cc21 |
| InChI | InChI=1S/C13H19FN2/c1-2-15-7-3-8-16-9-6-11-4-5-12(14)10-13(11)16/h4-5,10,15H,2-3,6-9H2,1H3 |
| InChIKey | MLBKDXOQHNUONT-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-3-(6-fluoro-2,3-dihydroindol-1-yl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-3-(6-fluoro-2,3-dihydroindol-1-yl)propan-1-amine?
The IUPAC name of N-ethyl-3-(6-fluoro-2,3-dihydroindol-1-yl)propan-1-amine (CID 103494949) is N-ethyl-3-(6-fluoro-2,3-dihydroindol-1-yl)propan-1-amine.
What is the SMILES notation for N-ethyl-3-(6-fluoro-2,3-dihydroindol-1-yl)propan-1-amine?
The canonical SMILES for N-ethyl-3-(6-fluoro-2,3-dihydroindol-1-yl)propan-1-amine is CCNCCCN1CCc2ccc(F)cc21.
What is the InChIKey of N-ethyl-3-(6-fluoro-2,3-dihydroindol-1-yl)propan-1-amine?
The InChIKey is MLBKDXOQHNUONT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19FN2/c1-2-15-7-3-8-16-9-6-11-4-5-12(14)10-13(11)16/h4-5,10,15H,2-3,6-9H2,1H3.
What are the key properties of N-ethyl-3-(6-fluoro-2,3-dihydroindol-1-yl)propan-1-amine?
N-ethyl-3-(6-fluoro-2,3-dihydroindol-1-yl)propan-1-amine has a molecular weight of 222.31 g/mol, XLogP of 2.19, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-3-(6-fluoro-2,3-dihydroindol-1-yl)propan-1-amine is sourced from PubChem (CID 103494949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).