C16H25FN2 — CID 106800163
N-ethyl-6-(6-fluoro-2,3-dihydroindol-1-yl)hexan-3-amine (PubChem CID 106800163) has the molecular formula C16H25FN2 and a molecular weight of 264.39 g/mol. Its IUPAC name is N-ethyl-6-(6-fluoro-2,3-dihydroindol-1-yl)hexan-3-amine.
| Compound Name | N-ethyl-6-(6-fluoro-2,3-dihydroindol-1-yl)hexan-3-amine |
|---|---|
| PubChem CID | 106800163 |
| Molecular Formula | C16H25FN2 |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.20 |
| IUPAC Name | N-ethyl-6-(6-fluoro-2,3-dihydroindol-1-yl)hexan-3-amine |
| SMILES | CCNC(CC)CCCN1CCc2ccc(F)cc21 |
| InChI | InChI=1S/C16H25FN2/c1-3-15(18-4-2)6-5-10-19-11-9-13-7-8-14(17)12-16(13)19/h7-8,12,15,18H,3-6,9-11H2,1-2H3 |
| InChIKey | KCZBYFDOGFNUNZ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |