About methyl 4-(6-fluoro-2,3-dihydroindol-1-yl)-2-(propylamino)butanoate
methyl 4-(6-fluoro-2,3-dihydroindol-1-yl)-2-(propylamino)butanoate (PubChem CID 103501880) has the molecular formula C16H23FN2O2
and a molecular weight of 294.37 g/mol. Its IUPAC name is methyl 4-(6-fluoro-2,3-dihydroindol-1-yl)-2-(propylamino)butanoate.
Molecular Properties
| Compound Name | methyl 4-(6-fluoro-2,3-dihydroindol-1-yl)-2-(propylamino)butanoate |
| PubChem CID | 103501880 |
| Molecular Formula | C16H23FN2O2 |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | methyl 4-(6-fluoro-2,3-dihydroindol-1-yl)-2-(propylamino)butanoate |
| SMILES | CCCNC(CCN1CCc2ccc(F)cc21)C(=O)OC |
| InChI | InChI=1S/C16H23FN2O2/c1-3-8-18-14(16(20)21-2)7-10-19-9-6-12-4-5-13(17)11-15(12)19/h4-5,11,14,18H,3,6-10H2,1-2H3 |
| InChIKey | AHJQXDFBGXQDJD-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 4-(6-fluoro-2,3-dihydroindol-1-yl)-2-(propylamino)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-(6-fluoro-2,3-dihydroindol-1-yl)-2-(propylamino)butanoate?
The IUPAC name of methyl 4-(6-fluoro-2,3-dihydroindol-1-yl)-2-(propylamino)butanoate (CID 103501880) is methyl 4-(6-fluoro-2,3-dihydroindol-1-yl)-2-(propylamino)butanoate.
What is the SMILES notation for methyl 4-(6-fluoro-2,3-dihydroindol-1-yl)-2-(propylamino)butanoate?
The canonical SMILES for methyl 4-(6-fluoro-2,3-dihydroindol-1-yl)-2-(propylamino)butanoate is CCCNC(CCN1CCc2ccc(F)cc21)C(=O)OC.
What is the InChIKey of methyl 4-(6-fluoro-2,3-dihydroindol-1-yl)-2-(propylamino)butanoate?
The InChIKey is AHJQXDFBGXQDJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23FN2O2/c1-3-8-18-14(16(20)21-2)7-10-19-9-6-12-4-5-13(17)11-15(12)19/h4-5,11,14,18H,3,6-10H2,1-2H3.
What are the key properties of methyl 4-(6-fluoro-2,3-dihydroindol-1-yl)-2-(propylamino)butanoate?
methyl 4-(6-fluoro-2,3-dihydroindol-1-yl)-2-(propylamino)butanoate has a molecular weight of 294.37 g/mol, XLogP of 2.12, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(6-fluoro-2,3-dihydroindol-1-yl)-2-(propylamino)butanoate is sourced from PubChem (CID 103501880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).