methyl 3-(6-fluoro-2,3-dihydroindol-1-yl)-2-methylpropanoate

C13H16FNO2 — CID 103497970

IUPACmethyl 3-(6-fluoro-2,3-dihydroindol-1-yl)-2-methylpropanoate
SMILESCOC(=O)C(C)CN1CCc2ccc(F)cc21
InChIInChI=1S/C13H16FNO2/c1-9(13(16)17-2)8-15-6-5-10-3-4-11(14)7-12(10)15/h3-4,7,9H,5-6,8H2,1-2H3
InChIKeyUPWSBAUKDSGSNJ-UHFFFAOYSA-N
MW237.27 g/mol
LogP2.00
Rot. Bonds3

About methyl 3-(6-fluoro-2,3-dihydroindol-1-yl)-2-methylpropanoate

methyl 3-(6-fluoro-2,3-dihydroindol-1-yl)-2-methylpropanoate (PubChem CID 103497970) has the molecular formula C13H16FNO2 and a molecular weight of 237.27 g/mol. Its IUPAC name is methyl 3-(6-fluoro-2,3-dihydroindol-1-yl)-2-methylpropanoate.

Molecular Properties

Compound Namemethyl 3-(6-fluoro-2,3-dihydroindol-1-yl)-2-methylpropanoate
PubChem CID103497970
Molecular FormulaC13H16FNO2
Molecular Weight237.27 g/mol
Exact Mass237.12
IUPAC Namemethyl 3-(6-fluoro-2,3-dihydroindol-1-yl)-2-methylpropanoate
SMILESCOC(=O)C(C)CN1CCc2ccc(F)cc21
InChIInChI=1S/C13H16FNO2/c1-9(13(16)17-2)8-15-6-5-10-3-4-11(14)7-12(10)15/h3-4,7,9H,5-6,8H2,1-2H3
InChIKeyUPWSBAUKDSGSNJ-UHFFFAOYSA-N
XLogP2.00
TPSA29.54 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500237.27
LogP ≤ 52.00
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 3-(6-fluoro-2,3-dihydroindol-1-yl)-2-methylpropanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-(6-fluoro-2,3-dihydroindol-1-yl)-2-methylpropanoate?
The IUPAC name of methyl 3-(6-fluoro-2,3-dihydroindol-1-yl)-2-methylpropanoate (CID 103497970) is methyl 3-(6-fluoro-2,3-dihydroindol-1-yl)-2-methylpropanoate.
What is the SMILES notation for methyl 3-(6-fluoro-2,3-dihydroindol-1-yl)-2-methylpropanoate?
The canonical SMILES for methyl 3-(6-fluoro-2,3-dihydroindol-1-yl)-2-methylpropanoate is COC(=O)C(C)CN1CCc2ccc(F)cc21.
What is the InChIKey of methyl 3-(6-fluoro-2,3-dihydroindol-1-yl)-2-methylpropanoate?
The InChIKey is UPWSBAUKDSGSNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16FNO2/c1-9(13(16)17-2)8-15-6-5-10-3-4-11(14)7-12(10)15/h3-4,7,9H,5-6,8H2,1-2H3.
What are the key properties of methyl 3-(6-fluoro-2,3-dihydroindol-1-yl)-2-methylpropanoate?
methyl 3-(6-fluoro-2,3-dihydroindol-1-yl)-2-methylpropanoate has a molecular weight of 237.27 g/mol, XLogP of 2.00, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(6-fluoro-2,3-dihydroindol-1-yl)-2-methylpropanoate is sourced from PubChem (CID 103497970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).