C14H18FNO — CID 106801628
6-(6-fluoro-2,3-dihydroindol-1-yl)hexan-3-one (PubChem CID 106801628) has the molecular formula C14H18FNO and a molecular weight of 235.30 g/mol. Its IUPAC name is 6-(6-fluoro-2,3-dihydroindol-1-yl)hexan-3-one.
| Compound Name | 6-(6-fluoro-2,3-dihydroindol-1-yl)hexan-3-one |
|---|---|
| PubChem CID | 106801628 |
| Molecular Formula | C14H18FNO |
| Molecular Weight | 235.30 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 6-(6-fluoro-2,3-dihydroindol-1-yl)hexan-3-one |
| SMILES | CCC(=O)CCCN1CCc2ccc(F)cc21 |
| InChI | InChI=1S/C14H18FNO/c1-2-13(17)4-3-8-16-9-7-11-5-6-12(15)10-14(11)16/h5-6,10H,2-4,7-9H2,1H3 |
| InChIKey | OGVPMCAQJZHSPQ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.30 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |