C12H16FN3O — CID 103503791
4-(6-fluoro-2,3-dihydroindol-1-yl)butanehydrazide (PubChem CID 103503791) has the molecular formula C12H16FN3O and a molecular weight of 237.28 g/mol. Its IUPAC name is 4-(6-fluoro-2,3-dihydroindol-1-yl)butanehydrazide.
| Compound Name | 4-(6-fluoro-2,3-dihydroindol-1-yl)butanehydrazide |
|---|---|
| PubChem CID | 103503791 |
| Molecular Formula | C12H16FN3O |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | 4-(6-fluoro-2,3-dihydroindol-1-yl)butanehydrazide |
| SMILES | NNC(=O)CCCN1CCc2ccc(F)cc21 |
| InChI | InChI=1S/C12H16FN3O/c13-10-4-3-9-5-7-16(11(9)8-10)6-1-2-12(17)15-14/h3-4,8H,1-2,5-7,14H2,(H,15,17) |
| InChIKey | YXQFWBARALGODY-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|