C16H16Cl2N2 — CID 54806092
2,3-dichloro-N-[2-(2,3-dihydroindol-1-yl)ethyl]aniline (PubChem CID 54806092) has the molecular formula C16H16Cl2N2 and a molecular weight of 307.22 g/mol. Its IUPAC name is 2,3-dichloro-N-[2-(2,3-dihydroindol-1-yl)ethyl]aniline.
| Compound Name | 2,3-dichloro-N-[2-(2,3-dihydroindol-1-yl)ethyl]aniline |
|---|---|
| PubChem CID | 54806092 |
| Molecular Formula | C16H16Cl2N2 |
| Molecular Weight | 307.22 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 2,3-dichloro-N-[2-(2,3-dihydroindol-1-yl)ethyl]aniline |
| SMILES | Clc1cccc(NCCN2CCc3ccccc32)c1Cl |
| InChI | InChI=1S/C16H16Cl2N2/c17-13-5-3-6-14(16(13)18)19-9-11-20-10-8-12-4-1-2-7-15(12)20/h1-7,19H,8-11H2 |
| InChIKey | QWSACJMLWOYRJU-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.22 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |