C17H19FN2 — CID 115980030
3-fluoro-5-[(6-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]aniline (PubChem CID 115980030) has the molecular formula C17H19FN2 and a molecular weight of 270.35 g/mol. Its IUPAC name is 3-fluoro-5-[(6-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]aniline.
| Compound Name | 3-fluoro-5-[(6-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]aniline |
|---|---|
| PubChem CID | 115980030 |
| Molecular Formula | C17H19FN2 |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 3-fluoro-5-[(6-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]aniline |
| SMILES | Cc1ccc2c(c1)CCCN2Cc1cc(N)cc(F)c1 |
| InChI | InChI=1S/C17H19FN2/c1-12-4-5-17-14(7-12)3-2-6-20(17)11-13-8-15(18)10-16(19)9-13/h4-5,7-10H,2-3,6,11,19H2,1H3 |
| InChIKey | RXOHOLKNRMRKHU-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|