C17H19ClN2 — CID 63405916
3-chloro-4-[(6-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]aniline (PubChem CID 63405916) has the molecular formula C17H19ClN2 and a molecular weight of 286.81 g/mol. Its IUPAC name is 3-chloro-4-[(6-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]aniline.
| Compound Name | 3-chloro-4-[(6-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]aniline |
|---|---|
| PubChem CID | 63405916 |
| Molecular Formula | C17H19ClN2 |
| Molecular Weight | 286.81 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 3-chloro-4-[(6-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]aniline |
| SMILES | Cc1ccc2c(c1)CCCN2Cc1ccc(N)cc1Cl |
| InChI | InChI=1S/C17H19ClN2/c1-12-4-7-17-13(9-12)3-2-8-20(17)11-14-5-6-15(19)10-16(14)18/h4-7,9-10H,2-3,8,11,19H2,1H3 |
| InChIKey | JYXGSSAWEUNXBR-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.81 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|