C17H19ClN2 — CID 106864235
1-[(2-chloro-4-methylphenyl)methyl]-5-methyl-2,3-dihydroindol-6-amine (PubChem CID 106864235) has the molecular formula C17H19ClN2 and a molecular weight of 286.81 g/mol. Its IUPAC name is 1-[(2-chloro-4-methylphenyl)methyl]-5-methyl-2,3-dihydroindol-6-amine.
| Compound Name | 1-[(2-chloro-4-methylphenyl)methyl]-5-methyl-2,3-dihydroindol-6-amine |
|---|---|
| PubChem CID | 106864235 |
| Molecular Formula | C17H19ClN2 |
| Molecular Weight | 286.81 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 1-[(2-chloro-4-methylphenyl)methyl]-5-methyl-2,3-dihydroindol-6-amine |
| SMILES | Cc1ccc(CN2CCc3cc(C)c(N)cc32)c(Cl)c1 |
| InChI | InChI=1S/C17H19ClN2/c1-11-3-4-14(15(18)7-11)10-20-6-5-13-8-12(2)16(19)9-17(13)20/h3-4,7-9H,5-6,10,19H2,1-2H3 |
| InChIKey | GAVJQHNTOOKBPV-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.81 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|