C16H16F2N2 — CID 114930465
1-[(2,6-difluorophenyl)methyl]-3,4-dihydro-2H-quinolin-6-amine (PubChem CID 114930465) has the molecular formula C16H16F2N2 and a molecular weight of 274.31 g/mol. Its IUPAC name is 1-[(2,6-difluorophenyl)methyl]-3,4-dihydro-2H-quinolin-6-amine.
| Compound Name | 1-[(2,6-difluorophenyl)methyl]-3,4-dihydro-2H-quinolin-6-amine |
|---|---|
| PubChem CID | 114930465 |
| Molecular Formula | C16H16F2N2 |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 1-[(2,6-difluorophenyl)methyl]-3,4-dihydro-2H-quinolin-6-amine |
| SMILES | Nc1ccc2c(c1)CCCN2Cc1c(F)cccc1F |
| InChI | InChI=1S/C16H16F2N2/c17-14-4-1-5-15(18)13(14)10-20-8-2-3-11-9-12(19)6-7-16(11)20/h1,4-7,9H,2-3,8,10,19H2 |
| InChIKey | OUZUQXDMBZTYJZ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|