C11H16N2S — CID 59090152
2-(6-amino-3,4-dihydro-2H-quinolin-1-yl)ethanethiol (PubChem CID 59090152) has the molecular formula C11H16N2S and a molecular weight of 208.33 g/mol. Its IUPAC name is 2-(6-amino-3,4-dihydro-2H-quinolin-1-yl)ethanethiol.
| Compound Name | 2-(6-amino-3,4-dihydro-2H-quinolin-1-yl)ethanethiol |
|---|---|
| PubChem CID | 59090152 |
| Molecular Formula | C11H16N2S |
| Molecular Weight | 208.33 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 2-(6-amino-3,4-dihydro-2H-quinolin-1-yl)ethanethiol |
| SMILES | Nc1ccc2c(c1)CCCN2CCS |
| InChI | InChI=1S/C11H16N2S/c12-10-3-4-11-9(8-10)2-1-5-13(11)6-7-14/h3-4,8,14H,1-2,5-7,12H2 |
| InChIKey | ZNMLQKPOMKCZJB-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.33 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|