C11H14N2OS — CID 115223654
6-amino-1-(2-sulfanylethyl)-3,4-dihydroquinolin-2-one (PubChem CID 115223654) has the molecular formula C11H14N2OS and a molecular weight of 222.31 g/mol. Its IUPAC name is 6-amino-1-(2-sulfanylethyl)-3,4-dihydroquinolin-2-one.
| Compound Name | 6-amino-1-(2-sulfanylethyl)-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 115223654 |
| Molecular Formula | C11H14N2OS |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 6-amino-1-(2-sulfanylethyl)-3,4-dihydroquinolin-2-one |
| SMILES | Nc1ccc2c(c1)CCC(=O)N2CCS |
| InChI | InChI=1S/C11H14N2OS/c12-9-2-3-10-8(7-9)1-4-11(14)13(10)5-6-15/h2-3,7,15H,1,4-6,12H2 |
| InChIKey | AQQNXTZBUVLGCS-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|