C12H13F3N2OS — CID 116615835
6-amino-1-[2-(trifluoromethylsulfanyl)ethyl]-3,4-dihydroquinolin-2-one (PubChem CID 116615835) has the molecular formula C12H13F3N2OS and a molecular weight of 290.31 g/mol. Its IUPAC name is 6-amino-1-[2-(trifluoromethylsulfanyl)ethyl]-3,4-dihydroquinolin-2-one.
| Compound Name | 6-amino-1-[2-(trifluoromethylsulfanyl)ethyl]-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 116615835 |
| Molecular Formula | C12H13F3N2OS |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 6-amino-1-[2-(trifluoromethylsulfanyl)ethyl]-3,4-dihydroquinolin-2-one |
| SMILES | Nc1ccc2c(c1)CCC(=O)N2CCSC(F)(F)F |
| InChI | InChI=1S/C12H13F3N2OS/c13-12(14,15)19-6-5-17-10-3-2-9(16)7-8(10)1-4-11(17)18/h2-3,7H,1,4-6,16H2 |
| InChIKey | IJBBYYVAUDWRAA-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.31 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|