C17H18N2OS — CID 79227394
6-amino-1-(2-phenylsulfanylethyl)-3,4-dihydroquinolin-2-one (PubChem CID 79227394) has the molecular formula C17H18N2OS and a molecular weight of 298.41 g/mol. Its IUPAC name is 6-amino-1-(2-phenylsulfanylethyl)-3,4-dihydroquinolin-2-one.
| Compound Name | 6-amino-1-(2-phenylsulfanylethyl)-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 79227394 |
| Molecular Formula | C17H18N2OS |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 6-amino-1-(2-phenylsulfanylethyl)-3,4-dihydroquinolin-2-one |
| SMILES | Nc1ccc2c(c1)CCC(=O)N2CCSc1ccccc1 |
| InChI | InChI=1S/C17H18N2OS/c18-14-7-8-16-13(12-14)6-9-17(20)19(16)10-11-21-15-4-2-1-3-5-15/h1-5,7-8,12H,6,9-11,18H2 |
| InChIKey | SVFCXQZPIFRUQZ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|