C14H16N4O — CID 61311449
6-amino-1-[(1-methylpyrazol-4-yl)methyl]-3,4-dihydroquinolin-2-one (PubChem CID 61311449) has the molecular formula C14H16N4O and a molecular weight of 256.31 g/mol. Its IUPAC name is 6-amino-1-[(1-methylpyrazol-4-yl)methyl]-3,4-dihydroquinolin-2-one.
| Compound Name | 6-amino-1-[(1-methylpyrazol-4-yl)methyl]-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 61311449 |
| Molecular Formula | C14H16N4O |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 6-amino-1-[(1-methylpyrazol-4-yl)methyl]-3,4-dihydroquinolin-2-one |
| SMILES | Cn1cc(CN2C(=O)CCc3cc(N)ccc32)cn1 |
| InChI | InChI=1S/C14H16N4O/c1-17-8-10(7-16-17)9-18-13-4-3-12(15)6-11(13)2-5-14(18)19/h3-4,6-8H,2,5,9,15H2,1H3 |
| InChIKey | NIFZVLNGIIIMEW-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|