C16H14F2N2O — CID 114930164
6-amino-1-[(2,6-difluorophenyl)methyl]-3,4-dihydroquinolin-2-one (PubChem CID 114930164) has the molecular formula C16H14F2N2O and a molecular weight of 288.30 g/mol. Its IUPAC name is 6-amino-1-[(2,6-difluorophenyl)methyl]-3,4-dihydroquinolin-2-one.
| Compound Name | 6-amino-1-[(2,6-difluorophenyl)methyl]-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 114930164 |
| Molecular Formula | C16H14F2N2O |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 6-amino-1-[(2,6-difluorophenyl)methyl]-3,4-dihydroquinolin-2-one |
| SMILES | Nc1ccc2c(c1)CCC(=O)N2Cc1c(F)cccc1F |
| InChI | InChI=1S/C16H14F2N2O/c17-13-2-1-3-14(18)12(13)9-20-15-6-5-11(19)8-10(15)4-7-16(20)21/h1-3,5-6,8H,4,7,9,19H2 |
| InChIKey | HVMPMSFQXDPDSD-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|