C16H12F2INO — CID 114935100
1-[(2,6-difluorophenyl)methyl]-6-iodo-3,4-dihydroquinolin-2-one (PubChem CID 114935100) has the molecular formula C16H12F2INO and a molecular weight of 399.18 g/mol. Its IUPAC name is 1-[(2,6-difluorophenyl)methyl]-6-iodo-3,4-dihydroquinolin-2-one.
| Compound Name | 1-[(2,6-difluorophenyl)methyl]-6-iodo-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 114935100 |
| Molecular Formula | C16H12F2INO |
| Molecular Weight | 399.18 g/mol |
| Exact Mass | 398.99 |
| IUPAC Name | 1-[(2,6-difluorophenyl)methyl]-6-iodo-3,4-dihydroquinolin-2-one |
| SMILES | O=C1CCc2cc(I)ccc2N1Cc1c(F)cccc1F |
| InChI | InChI=1S/C16H12F2INO/c17-13-2-1-3-14(18)12(13)9-20-15-6-5-11(19)8-10(15)4-7-16(20)21/h1-3,5-6,8H,4,7,9H2 |
| InChIKey | NRUDWUIROSXSNS-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.18 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|