C16H12Cl2INO — CID 79783131
1-[(3,4-dichlorophenyl)methyl]-6-iodo-3,4-dihydroquinolin-2-one (PubChem CID 79783131) has the molecular formula C16H12Cl2INO and a molecular weight of 432.09 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methyl]-6-iodo-3,4-dihydroquinolin-2-one.
| Compound Name | 1-[(3,4-dichlorophenyl)methyl]-6-iodo-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 79783131 |
| Molecular Formula | C16H12Cl2INO |
| Molecular Weight | 432.09 g/mol |
| Exact Mass | 430.93 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methyl]-6-iodo-3,4-dihydroquinolin-2-one |
| SMILES | O=C1CCc2cc(I)ccc2N1Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H12Cl2INO/c17-13-4-1-10(7-14(13)18)9-20-15-5-3-12(19)8-11(15)2-6-16(20)21/h1,3-5,7-8H,2,6,9H2 |
| InChIKey | CFFFUWWFIGXJAM-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.09 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|