C18H18INO — CID 79783150
1-[(2,5-dimethylphenyl)methyl]-6-iodo-3,4-dihydroquinolin-2-one (PubChem CID 79783150) has the molecular formula C18H18INO and a molecular weight of 391.25 g/mol. Its IUPAC name is 1-[(2,5-dimethylphenyl)methyl]-6-iodo-3,4-dihydroquinolin-2-one.
| Compound Name | 1-[(2,5-dimethylphenyl)methyl]-6-iodo-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 79783150 |
| Molecular Formula | C18H18INO |
| Molecular Weight | 391.25 g/mol |
| Exact Mass | 391.04 |
| IUPAC Name | 1-[(2,5-dimethylphenyl)methyl]-6-iodo-3,4-dihydroquinolin-2-one |
| SMILES | Cc1ccc(C)c(CN2C(=O)CCc3cc(I)ccc32)c1 |
| InChI | InChI=1S/C18H18INO/c1-12-3-4-13(2)15(9-12)11-20-17-7-6-16(19)10-14(17)5-8-18(20)21/h3-4,6-7,9-10H,5,8,11H2,1-2H3 |
| InChIKey | KZKHJRSMTVRNGQ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.25 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|