C16H13ClINO — CID 79784832
1-[(4-chlorophenyl)methyl]-6-iodo-3,4-dihydroquinolin-2-one (PubChem CID 79784832) has the molecular formula C16H13ClINO and a molecular weight of 397.64 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-6-iodo-3,4-dihydroquinolin-2-one.
| Compound Name | 1-[(4-chlorophenyl)methyl]-6-iodo-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 79784832 |
| Molecular Formula | C16H13ClINO |
| Molecular Weight | 397.64 g/mol |
| Exact Mass | 396.97 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-6-iodo-3,4-dihydroquinolin-2-one |
| SMILES | O=C1CCc2cc(I)ccc2N1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H13ClINO/c17-13-4-1-11(2-5-13)10-19-15-7-6-14(18)9-12(15)3-8-16(19)20/h1-2,4-7,9H,3,8,10H2 |
| InChIKey | JMFWLZXYVXUVCJ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.64 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|