C16H12BrFINO — CID 79783152
1-[(3-bromo-5-fluorophenyl)methyl]-6-iodo-3,4-dihydroquinolin-2-one (PubChem CID 79783152) has the molecular formula C16H12BrFINO and a molecular weight of 460.08 g/mol. Its IUPAC name is 1-[(3-bromo-5-fluorophenyl)methyl]-6-iodo-3,4-dihydroquinolin-2-one.
| Compound Name | 1-[(3-bromo-5-fluorophenyl)methyl]-6-iodo-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 79783152 |
| Molecular Formula | C16H12BrFINO |
| Molecular Weight | 460.08 g/mol |
| Exact Mass | 458.91 |
| IUPAC Name | 1-[(3-bromo-5-fluorophenyl)methyl]-6-iodo-3,4-dihydroquinolin-2-one |
| SMILES | O=C1CCc2cc(I)ccc2N1Cc1cc(F)cc(Br)c1 |
| InChI | InChI=1S/C16H12BrFINO/c17-12-5-10(6-13(18)8-12)9-20-15-3-2-14(19)7-11(15)1-4-16(20)21/h2-3,5-8H,1,4,9H2 |
| InChIKey | HQNZSLQAHFUFGD-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.08 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|